What is the structure of c9h10o2?

There are 580 commercially available compounds with a molecular formula “C9H10O2” in MolPort database….Molecules By Molecular Formula “C9H10O2”

Compound number:	MolPort-004-780-847
SMILES:	COC(=O)C1=C[C@H]2C[C@H]1C=C2 |r,c:10,t:4|
Molecular weight:	150.18

How many signals does the NMR have?

Nuclear Magnetic Resonance (NMR) Spectroscopy The spectrum has five signals which indicates five types of different protons.

What is the molar mass of C9H10O2?

150.18 g/mol
The molecular formula C9H10O2 (molar mass: 150.18 g/mol, exact mass: 150.06808 u) may refer to: Acetanisole.

Is C9H10O2 soluble in water?

Ethyl benzoate, C9H10O2, is the ester formed by the condensation of benzoic acid and ethanol. It is a colorless liquid that is almost insoluble in water, but miscible with most organic solvents.

What is equivalent proton?

spectrum. Chemically equivalent protons: protons in the same chemical environment. Chemically non-equivalent protons: protons in the different chemical environment.

How many proton signals would you expect to find in the 1H NMR spectrum of the following compound?

3 signals
Hence there are 3 signals appears in the 1H -NMR spectrum of 1,3-dibromobenzene.

What is the molar mass of c4h8o?

72.11 g/molButyraldehyde / Molar mass

What is the molar mass of c4h11n?

73.14 g/moln-Butylamine / Molar mass

What does methyl benzoate smell like?

Methyl benzoate has a pleasant smell, strongly reminiscent of the fruit of the feijoa tree, and it is used in perfumery. It also finds use as a solvent and as a pesticide used to attract insects such as orchid bees.

What is equivalent proton in NMR?

In the terminology of NMR, all three Ha protons are chemically equivalent to each other, as are all three Hb protons. The Ha protons are, however, chemically nonequivalent to the Hb protons. As a consequence, the resonance frequency of the Ha protons is different from that of the Hb protons.